Products 2836996-95-1
CAS 2836996-95-1 is the registry number for DPP IV/hCA II-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-amino-3-(2,3-dihydro-1,4-benzodioxin-3-yl)propoxy]benzenesulfonamide (CAS 2836996-95-1) is a chemical compound with the molecular formula C17H20N2O5S and a molecular weight of 364.4 g/mol. IUPAC name: 4-[3-amino-3-(2,3-dihydro-1,4-benzodioxin-3-yl)propoxy]benzenesulfonamide. InChIKey: GHVPEVBTYVRTHA-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O5S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[3-amino-3-(2,3-dihydro-1,4-benzodioxin-3-yl)propoxy]benzenesulfonamide |
| InChIKey | GHVPEVBTYVRTHA-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(CCOC3=CC=C(C=C3)S(=O)(=O)N)N |
Computed by PubChem (NCBI)
Synonyms:
DPP IV/hCA II-IN-1, orb1982445