Products 2863686-81-9
CAS 2863686-81-9 appears in our catalog under these names: DRB18/ 98.74% (existing batch purity), DRB18, 5,5'-(((4-Chloro-1,2-phenylene)bis(azanediyl))bis(methylene))bis(2-methylphenol), 98%, 98%, DRB18, 99.58%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
5-[[4-chloro-2-[(3-hydroxy-4-methylphenyl)methylamino]anilino]methyl]-2-methylphenol (CAS 2863686-81-9) is a chemical compound with the molecular formula C22H23ClN2O2 and a molecular weight of 382.9 g/mol. IUPAC name: 5-[[4-chloro-2-[(3-hydroxy-4-methylphenyl)methylamino]anilino]methyl]-2-methylphenol. InChIKey: WNTAQMQIZGJASL-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O2 |
|---|---|
| Molecular weight | 382.9 g/mol |
| IUPAC name | 5-[[4-chloro-2-[(3-hydroxy-4-methylphenyl)methylamino]anilino]methyl]-2-methylphenol |
| InChIKey | WNTAQMQIZGJASL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CNC2=C(C=C(C=C2)Cl)NCC3=CC(=C(C=C3)C)O)O |
Computed by PubChem (NCBI)