CAS 7261-97-4 appears in our catalog under these names: Dantrolene, >95% (HPLC), Dantrolene, Dantrolene/ 100%, 1-{{(5-(4-Nitrophenyl)-2-furanyl)methylene}amino}-2,4-imidazolidinedione, Dantrolene, >95.0%(HPLC)(qNMR). Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 5mg, 10mg, 200mg, 500mg.
1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione (CAS 7261-97-4) is a chemical compound with the molecular formula C14H10N4O5 and a molecular weight of 314.25 g/mol. IUPAC name: 1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione. InChIKey: OZOMQRBLCMDCEG-VIZOYTHASA-N.
| Molecular formula | C14H10N4O5 |
|---|---|
| Molecular weight | 314.25 g/mol |
| IUPAC name | 1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione |
| InChIKey | OZOMQRBLCMDCEG-VIZOYTHASA-N |
| SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)