Products 84629-61-8
CAS 84629-61-8 appears in our catalog under these names: Darenzepine/ 99.9%, Darenzepine. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(11E)-11-[2-(4-methylpiperazin-1-yl)-2-oxoethylidene]-5H-benzo[c][1]benzazepin-6-one (CAS 84629-61-8) is a chemical compound with the molecular formula C21H21N3O2 and a molecular weight of 347.4 g/mol. IUPAC name: (11E)-11-[2-(4-methylpiperazin-1-yl)-2-oxoethylidene]-5H-benzo[c][1]benzazepin-6-one. InChIKey: VBQROPPRMFZXNC-NBVRZTHBSA-N.
| Molecular formula | C21H21N3O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (11E)-11-[2-(4-methylpiperazin-1-yl)-2-oxoethylidene]-5H-benzo[c][1]benzazepin-6-one |
| InChIKey | VBQROPPRMFZXNC-NBVRZTHBSA-N |
| SMILES | CN1CCN(CC1)C(=O)/C=C/2\C3=CC=CC=C3C(=O)NC4=CC=CC=C42 |
Computed by PubChem (NCBI)