Products 16401-80-2
CAS 16401-80-2 appears in our catalog under these names: Delmetacin/ 99.42% (existing batch purity), Delmetacin. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
2-(1-benzoyl-2-methylindol-3-yl)acetic acid (CAS 16401-80-2) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 2-(1-benzoyl-2-methylindol-3-yl)acetic acid. InChIKey: AZCOEIZFVQEQCU-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 2-(1-benzoyl-2-methylindol-3-yl)acetic acid |
| InChIKey | AZCOEIZFVQEQCU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C(=O)C3=CC=CC=C3)CC(=O)O |
Computed by PubChem (NCBI)