cas: 1326242-72-1 — see every product listed under this CAS number, including other names
Di-tert-butyl 1-(bicyclo[1.1.1]pentan-1-yl)hydrazine-1,2-dicarboxylate 95% (CAS 1326242-72-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A858940-50mg |
| cas | 1326242-72-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 526.12 Pln | |
| Ambeed | 100mg | 826.50 Pln | |
| Ambeed | 250mg | 1594.12 Pln | |
| Ambeed | 1g | 3902.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A858940 |
Tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 1326242-72-1) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: FEPHQWPVQIMVGG-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | FEPHQWPVQIMVGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C12CC(C1)C2 |
Computed by PubChem (NCBI)