cas: 128988-04-5 — see every product listed under this CAS number, including other names
Di-tert-butyl 3,3'-azanediyldipropanoate, 95%, 95% (CAS 128988-04-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YQW-50g |
| cas | 128988-04-5 |
| size | 50g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4336.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1576.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate (CAS 128988-04-5) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate. InChIKey: KCTOWZYKZDFZMQ-UHFFFAOYSA-N.
| Molecular formula | C14H27NO4 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate |
| InChIKey | KCTOWZYKZDFZMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCNCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)