CAS 947586-93-8 appears in our catalog under these names: Atorvastatin Impurity 8, tert-Butyl 2-((4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%, Atorvastatin Impurity 10, Atorvastatin Impurity 59, (4S,cis)-1,1-Dimethylethyl-6-aminoethyl-2,2-dimethyl-1,3-dioxane-4-acetate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
Tert-butyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 947586-93-8) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: tert-butyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: HWSHVKNLMBMKSR-QWRGUYRKSA-N.
| Molecular formula | C14H27NO4 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | HWSHVKNLMBMKSR-QWRGUYRKSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CC(=O)OC(C)(C)C)CCN)C |
Computed by PubChem (NCBI)