Products 2348328-55-0
CAS 2348328-55-0 is the registry number for tert-Butyl (2S,4R)-4-(tert-butoxy)-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate (CAS 2348328-55-0) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate. InChIKey: OGGZMTNZFQXGEK-WDEREUQCSA-N.
| Molecular formula | C14H27NO4 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate |
| InChIKey | OGGZMTNZFQXGEK-WDEREUQCSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](N(C1)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)