CAS 128988-04-5 appears in our catalog under these names: N-Bis(tert-butylpropionate)amine, 97%, Di–tert–butyl 3,3'–Iminodipropionate, Di-tert-butyl 3,3'-Iminodipropionate, >97.0%(GC)(T), Di-tert-butyl 3,3'-azanediyldipropanoate 97%, Di-tert-butyl 3,3'-azanediyldipropanoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 50g, 100g, 10g.
Tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate (CAS 128988-04-5) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate. InChIKey: KCTOWZYKZDFZMQ-UHFFFAOYSA-N.
| Molecular formula | C14H27NO4 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | tert-butyl 3-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]propanoate |
| InChIKey | KCTOWZYKZDFZMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCNCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)