cas: 261507-84-0 — see every product listed under this CAS number, including other names
Di-tert-butyl 5-hydroxydihydropyrimidine-1,3(2H,4H)-dicarboxylate, 95+% (CAS 261507-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A112193-1g |
| cas | 261507-84-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7348.18 Pln | |
| AmBeed | 5g | 21819.91 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate (CAS 261507-84-0) is a chemical compound with the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. IUPAC name: ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate. InChIKey: WUMWHTXGFGFRLV-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O5 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate |
| InChIKey | WUMWHTXGFGFRLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)