Products 243973-69-5
CAS 243973-69-5 appears in our catalog under these names: 4,5-Bis-tert-butyloxycarbonyl[1,4,5]oxadiazepane, 98%, Di–tert–butyl 1,4,5–oxadiazepane–4,5–dicarboxylate, Di-tert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate 98%, Di-tert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate, 98%, 98%, Di-tert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
Ditert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate (CAS 243973-69-5) is a chemical compound with the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. IUPAC name: ditert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate. InChIKey: IOJNWYJYJHXUNU-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O5 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | ditert-butyl 1,4,5-oxadiazepane-4,5-dicarboxylate |
| InChIKey | IOJNWYJYJHXUNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)