CAS 27610-07-7 is the registry number for methyl 2-[(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-methylpentanamido]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate (CAS 27610-07-7) is a chemical compound with the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. IUPAC name: methyl 2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate. InChIKey: HTIJIMPAAGOOKD-JTQLQIEISA-N.
| Molecular formula | C14H26N2O5 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | methyl 2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetate |
| InChIKey | HTIJIMPAAGOOKD-JTQLQIEISA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)