Products 261507-84-0
CAS 261507-84-0 appears in our catalog under these names: Di-tert-butyl 5-hydroxydihydropyrimidine-1,3(2h,4h)-dicarboxylate, 95%, Di-tert-butyl 5-hydroxydihydropyrimidine-1,3(2H,4H)-dicarboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate (CAS 261507-84-0) is a chemical compound with the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. IUPAC name: ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate. InChIKey: WUMWHTXGFGFRLV-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O5 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | ditert-butyl 5-hydroxy-1,3-diazinane-1,3-dicarboxylate |
| InChIKey | WUMWHTXGFGFRLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)