CAS 66086-33-7 appears in our catalog under these names: Di-tert-butyl acetylenedicarboxylate, 95%, DI-TERT-BUTYL ACETYLENEDICARBOXYLATE, 9&, Di-tert-butyl acetylenedicarboxylate, 98%(GC-MS),RG. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Ditert-butyl but-2-ynedioate (CAS 66086-33-7) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: ditert-butyl but-2-ynedioate. InChIKey: FBCRUXRGQFLOMC-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ditert-butyl but-2-ynedioate |
| InChIKey | FBCRUXRGQFLOMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C#CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)