CAS 66478-66-8 appears in our catalog under these names: 3,4-Di(tert-butoxy)-3-cyclobutene-1,2-dione, 95%, 3,4-Di-tert-butoxycyclobut-3-ene-1,2-dione, 3,4–di–tert–butoxycyclobut–3–ene–1,2–dione, 3,4-Bis(1,1-dimethylethoxy)-3-cyclobutene-1,2-dione, 3,4-Di-tert-butoxycyclobut-3-ene-1,2-dione 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 500mg, 5g, 10g, 100mg.
3,4-bis[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione (CAS 66478-66-8) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 3,4-bis[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione. InChIKey: GFBOYCVDBGFJFT-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3,4-bis[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
| InChIKey | GFBOYCVDBGFJFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C(=O)C1=O)OC(C)(C)C |
Computed by PubChem (NCBI)