CAS 1459-96-7 appears in our catalog under these names: Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate, 95%, Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate 95%, Dimethyl Bicyclo[2.2.2]octane-1,4-dicarboxylate, >95%, >95%, Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500g, 25g, 100g, 10g, 50g.
Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate (CAS 1459-96-7) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate. InChIKey: HDOVTVDGSLEUSK-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate |
| InChIKey | HDOVTVDGSLEUSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2)C(=O)OC |
Computed by PubChem (NCBI)