Di-tert-butyl hydrogen phosphate, 95%
cas: 33494-81-4 — see every product listed under this CAS number, including other names
Di-tert-butyl hydrogen phosphate, 95% (CAS 33494-81-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A275719-250mg |
| cas | 33494-81-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1149.12 Pln | |
| Ambeed | 25g | 4358.69 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1236.26 Pln | |
| BLDpharm | 25g | 4690.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ditert-butyl hydrogen phosphate (CAS 33494-81-4) is a chemical compound with the molecular formula C8H19O4P and a molecular weight of 210.21 g/mol. IUPAC name: ditert-butyl hydrogen phosphate. InChIKey: YEWZQCDRZRYAEB-UHFFFAOYSA-N.
| Molecular formula | C8H19O4P |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | ditert-butyl hydrogen phosphate |
| InChIKey | YEWZQCDRZRYAEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di-tert-butyl phosphate, Phosphoric acid, bis(1,1-dimethylethyl) ester, Di-tert-butyl hydrogen phosphate, Di-t-butyl phosphoric acid, ditert-butyl hydrogen phosphate, BIS(TERT-BUTOXY)PHOSPHINIC ACID, Phosphoric acid di-tert-butyl ester, DI-TERT-BUTYL PHOSPHORIC ACID, di-t-butyl phosphate, Di(tert-butyl) hydrogen phosphate