Products 156213-21-7
CAS 156213-21-7 appears in our catalog under these names: Dibutyl Phosphate-d18, >95% (HPLC), Dibutyl phosphate–d18, Dibutyl phosphate-d18, 98.45%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 1 mg, 10 mg, 50 mg, 100 mg, 5 mg, 25 mg.
Bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) hydrogen phosphate (CAS 156213-21-7) is a chemical compound with the molecular formula C8H19O4P and a molecular weight of 228.32 g/mol. IUPAC name: bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) hydrogen phosphate. InChIKey: JYFHYPJRHGVZDY-VAZJTQEUSA-N.
| Molecular formula | C8H19O4P |
|---|---|
| Molecular weight | 228.32 g/mol |
| IUPAC name | bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) hydrogen phosphate |
| InChIKey | JYFHYPJRHGVZDY-VAZJTQEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OP(=O)(O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)