Products 33494-81-4
CAS 33494-81-4 appears in our catalog under these names: Di-t-butyl phosphoric acid, 95%, Di-tert-butyl Phosphate, Di–tert–butyl hydrogen phosphate, Di-tert-butyl hydrogen phosphate 95%, Di-tert-butyl hydrogen phosphate, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 100mg.
Ditert-butyl hydrogen phosphate (CAS 33494-81-4) is a chemical compound with the molecular formula C8H19O4P and a molecular weight of 210.21 g/mol. IUPAC name: ditert-butyl hydrogen phosphate. InChIKey: YEWZQCDRZRYAEB-UHFFFAOYSA-N.
| Molecular formula | C8H19O4P |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | ditert-butyl hydrogen phosphate |
| InChIKey | YEWZQCDRZRYAEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di-tert-butyl phosphate, Phosphoric acid, bis(1,1-dimethylethyl) ester, Di-tert-butyl hydrogen phosphate, Di-t-butyl phosphoric acid, ditert-butyl hydrogen phosphate, BIS(TERT-BUTOXY)PHOSPHINIC ACID, Phosphoric acid di-tert-butyl ester, DI-TERT-BUTYL PHOSPHORIC ACID, di-t-butyl phosphate, Di(tert-butyl) hydrogen phosphate