Products 1070-03-7

CAS 1070-03-7 is the registry number for Phosphoric acid, mono(2-ethylhexyl) ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethylhexyl dihydrogen phosphate (CAS 1070-03-7) is a chemical compound with the molecular formula C8H19O4P and a molecular weight of 210.21 g/mol. IUPAC name: 2-ethylhexyl dihydrogen phosphate. InChIKey: LJKDOMVGKKPJBH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H19O4P
Molecular weight210.21 g/mol
IUPAC name2-ethylhexyl dihydrogen phosphate
InChIKeyLJKDOMVGKKPJBH-UHFFFAOYSA-N
SMILESCCCCC(CC)COP(=O)(O)O

Computed by PubChem (NCBI)