cas: 76535-75-6 — see every product listed under this CAS number, including other names
Di-tert-butyl piperazine-1,4-dicarboxylate, 95% (CAS 76535-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212849-250MG |
| cas | 76535-75-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1106.92 Pln | |
| Fluorochem | 500g | 5318.98 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ditert-butyl piperazine-1,4-dicarboxylate (CAS 76535-75-6) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl piperazine-1,4-dicarboxylate. InChIKey: YROXEBCFDJQGOH-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl piperazine-1,4-dicarboxylate |
| InChIKey | YROXEBCFDJQGOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)