Products 1246816-49-8
CAS 1246816-49-8 appears in our catalog under these names: 1,4-Bis(tert-boc)piperazine-d8, 1,4-Bis(tert-butoxycarbonyl)piperazine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 25 mg, 100 mg, 50 mg.
Ditert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate (CAS 1246816-49-8) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 294.42 g/mol. IUPAC name: ditert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate. InChIKey: YROXEBCFDJQGOH-UFBJYANTSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 294.42 g/mol |
| IUPAC name | ditert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate |
| InChIKey | YROXEBCFDJQGOH-UFBJYANTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C(=O)OC(C)(C)C)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)