cas: 76535-75-6 — see every product listed under this CAS number, including other names
Di-tert-butyl piperazine-1,4-dicarboxylate, 98%, 98% (CAS 76535-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116BJ9-250mg |
| cas | 76535-75-6 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1163.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl piperazine-1,4-dicarboxylate (CAS 76535-75-6) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl piperazine-1,4-dicarboxylate. InChIKey: YROXEBCFDJQGOH-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl piperazine-1,4-dicarboxylate |
| InChIKey | YROXEBCFDJQGOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)