Products 83056-49-9
CAS 83056-49-9 appears in our catalog under these names: Diazepam-D3, Diazepam-D3, 0.1mg/ml in Methanol, Diazepam-D3, 1mg/ml in Methanol. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg, 1ml.
7-chloro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 83056-49-9) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 287.76 g/mol. IUPAC name: 7-chloro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: AAOVKJBEBIDNHE-FIBGUPNXSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | 7-chloro-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | AAOVKJBEBIDNHE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)