CAS 1346597-86-1 is the registry number for rac Clobenzorex-d6 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
N-[(2-chlorophenyl)methyl]-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride (CAS 1346597-86-1) is a chemical compound with the molecular formula C16H19Cl2N and a molecular weight of 302.3 g/mol. IUPAC name: N-[(2-chlorophenyl)methyl]-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride. InChIKey: ASTCUURTJCZRSC-WXVCLZDVSA-N.
| Molecular formula | C16H19Cl2N |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | N-[(2-chlorophenyl)methyl]-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride |
| InChIKey | ASTCUURTJCZRSC-WXVCLZDVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])C1=CC=CC=C1)NCC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)