CAS 85911-38-2 appears in our catalog under these names: 4-(Adamantan-1-yl)-2,6-dichloroaniline, 95%, 4-(Adamantan-1-yl)-2,6-dichloroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(1-adamantyl)-2,6-dichloroaniline (CAS 85911-38-2) is a chemical compound with the molecular formula C16H19Cl2N and a molecular weight of 296.2 g/mol. IUPAC name: 4-(1-adamantyl)-2,6-dichloroaniline. InChIKey: BNXOMMYBHYQEAX-UHFFFAOYSA-N.
| Molecular formula | C16H19Cl2N |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4-(1-adamantyl)-2,6-dichloroaniline |
| InChIKey | BNXOMMYBHYQEAX-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC(=C(C(=C4)Cl)N)Cl |
Computed by PubChem (NCBI)