cas: 100124-06-9 — see every product listed under this CAS number, including other names
Dibenzofuran-4-boronic acid, 98%, 98% (CAS 100124-06-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1kg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11121T-50g |
| cas | 100124-06-9 |
| size | 50g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 155.60 Pln | |
| Chemat | 250g | 510.80 Pln | |
| Chemat | 1kg | 1965.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 242.00 Pln | |
| Chemat | 500g | 1022.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dibenzofuran-4-ylboronic acid (CAS 100124-06-9) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-4-ylboronic acid. InChIKey: ZXHUJRZYLRVVNP-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | dibenzofuran-4-ylboronic acid |
| InChIKey | ZXHUJRZYLRVVNP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C3=CC=CC=C3O2)(O)O |
Computed by PubChem (NCBI)