Products 100124-06-9
CAS 100124-06-9 appears in our catalog under these names: 4–(Dibenzofuranyl)boronic acid (contains varying amounts of Anhydride), Dibenzofuran-4-boronic acid, 98+% , Dibenzofuran-4-boronic Acid (contains varying amounts of Anhydride), 4-(Dibenzofuranyl)boronic acid 98%, Dibenzofuran-4-boronic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g, 50g, 250g.
Dibenzofuran-4-ylboronic acid (CAS 100124-06-9) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-4-ylboronic acid. InChIKey: ZXHUJRZYLRVVNP-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | dibenzofuran-4-ylboronic acid |
| InChIKey | ZXHUJRZYLRVVNP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C3=CC=CC=C3O2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzofuran-4-boronic acid, dibenzo[b,d]furan-4-ylboronic acid, 4-Dibenzofuranboronic acid, 4-(Dibenzofuranyl)Boronic Acid, dibenzofuran-4-ylboronic acid, Boronic acid, B-4-dibenzofuranyl-, dibenzo(b,d)furan-4-ylboronic acid, 4-dibenzofuranylboronic acid, Boronic acid, 4-dibenzofuranyl-, 4-dibenzofurylboronic acid