CAS 402936-15-6 appears in our catalog under these names: 8-Oxatricyclo[7.4.0.0(2,7)]trideca-1(9),2(7),3,5,10,12-hexaen-4-ylboranediol, 97%, B–2–Dibenzofuranylboronic acid, Dibenzo[b,d]furan-2-ylboronic Acid (contains varying amounts of Anhydride), Dibenzo[b,d]furan-2-ylboronic acid 95%, Dibenzofuran-2-ylboronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 500g, 50g, 250g.
Dibenzofuran-2-ylboronic acid (CAS 402936-15-6) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-2-ylboronic acid. InChIKey: DSSBJZCMMKRJTF-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | dibenzofuran-2-ylboronic acid |
| InChIKey | DSSBJZCMMKRJTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)