CAS 162607-19-4 appears in our catalog under these names: Dibenzofuran-1-boronic Acid (contains varying amounts of Anhydride), Dibenzo[b,d]furan-1-ylboronic acid 97%, 1-Dibenzofuranylboronic Acid, 99.9%, 99.9%, Dibenzo[b,d]furan-1-ylboronic acid, 97%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g.
Dibenzofuran-1-ylboronic acid (CAS 162607-19-4) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-1-ylboronic acid. InChIKey: JOFBTOVNZIUWPX-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | dibenzofuran-1-ylboronic acid |
| InChIKey | JOFBTOVNZIUWPX-UHFFFAOYSA-N |
| SMILES | B(C1=C2C3=CC=CC=C3OC2=CC=C1)(O)O |
Computed by PubChem (NCBI)