Products 162607-19-4

CAS 162607-19-4 appears in our catalog under these names: Dibenzofuran-1-boronic Acid (contains varying amounts of Anhydride), Dibenzo[b,d]furan-1-ylboronic acid 97%, 1-Dibenzofuranylboronic Acid, 99.9%, 99.9%, Dibenzo[b,d]furan-1-ylboronic acid, 97%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g.

Structural formula: {0} (CAS {1})

Dibenzofuran-1-ylboronic acid (CAS 162607-19-4) is a chemical compound with the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. IUPAC name: dibenzofuran-1-ylboronic acid. InChIKey: JOFBTOVNZIUWPX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BO3
Molecular weight212.01 g/mol
IUPAC namedibenzofuran-1-ylboronic acid
InChIKeyJOFBTOVNZIUWPX-UHFFFAOYSA-N
SMILESB(C1=C2C3=CC=CC=C3OC2=CC=C1)(O)O

Computed by PubChem (NCBI)