cas: 87-92-3 — see every product listed under this CAS number, including other names
Dibutyl L-(+)-Tartrate, >98.0%(GC) (CAS 87-92-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0005-25G |
| cas | 87-92-3 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 167.52 Pln | |
| TCI | 500g | 1293.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Dibutyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 87-92-3) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: dibutyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PCYQQSKDZQTOQG-NXEZZACHSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | dibutyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PCYQQSKDZQTOQG-NXEZZACHSA-N |
| SMILES | CCCCOC(=O)[C@@H]([C@H](C(=O)OCCCC)O)O |
Computed by PubChem (NCBI)