cas: 87-92-3 — see every product listed under this CAS number, including other names
L-(+)-Tartaric acid dibutyl ester, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 87-92-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PKT-5g |
| cas | 87-92-3 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 678.80 Pln | |
| Chemat | 500g | 1502.40 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Dibutyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 87-92-3) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: dibutyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PCYQQSKDZQTOQG-NXEZZACHSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | dibutyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PCYQQSKDZQTOQG-NXEZZACHSA-N |
| SMILES | CCCCOC(=O)[C@@H]([C@H](C(=O)OCCCC)O)O |
Computed by PubChem (NCBI)