cas: 62965-37-1 — see every product listed under this CAS number, including other names
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoate, 97% (CAS 62965-37-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100g, 25g, 1g. Offered by: Fluorochem, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F987207-5G |
| cas | 62965-37-1 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 100g | 549.82 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 242.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 192.18 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
N-cyclohexylcyclohexanamine;(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 62965-37-1) is a chemical compound with the molecular formula C26H42N2O4 and a molecular weight of 446.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: ZZVHEFCADXTNTP-RFVHGSKJSA-N.
| Molecular formula | C26H42N2O4 |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | ZZVHEFCADXTNTP-RFVHGSKJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)