cas: 76-67-5 — see every product listed under this CAS number, including other names
Diethyl 2-ethyl-2-phenylmalonate (CAS 76-67-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212402-5G |
| cas | 76-67-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 50g | 185.37 Pln | |
| Fluorochem | 100g | 227.02 Pln | |
| Fluorochem | 500g | 685.19 Pln |
| delivery time | 2-3 weeks |
|---|
Diethyl 2-ethyl-2-phenylpropanedioate (CAS 76-67-5) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: diethyl 2-ethyl-2-phenylpropanedioate. InChIKey: PKRVDBARWFJWEB-UHFFFAOYSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | diethyl 2-ethyl-2-phenylpropanedioate |
| InChIKey | PKRVDBARWFJWEB-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)