Products 2411591-96-1
CAS 2411591-96-1 appears in our catalog under these names: (S)–Methyl 3–(1–(tert–butoxy)–1–oxopropan–2–yl)benzoate, Methyl (s)-3-(1-(tert-butoxy)-1-oxopropan-2-yl)benzoate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]benzoate (CAS 2411591-96-1) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: methyl 3-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]benzoate. InChIKey: WDHBITOCHSJBMF-JTQLQIEISA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | methyl 3-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]benzoate |
| InChIKey | WDHBITOCHSJBMF-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)