Products 86179-99-9

CAS 86179-99-9 is the registry number for 3-(acetyloxy)-5-pentylphenyl acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(3-acetyloxy-5-pentylphenyl) acetate (CAS 86179-99-9) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: (3-acetyloxy-5-pentylphenyl) acetate. InChIKey: BXZGXBRWQJFVFV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O4
Molecular weight264.32 g/mol
IUPAC name(3-acetyloxy-5-pentylphenyl) acetate
InChIKeyBXZGXBRWQJFVFV-UHFFFAOYSA-N
SMILESCCCCCC1=CC(=CC(=C1)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)