CAS 337518-87-3 appears in our catalog under these names: (S)-2-Benzyl-4-(tert-butoxy)-4-oxobutanoic acid, 95%, (S)–2–BENZYL–4–(TERT–BUTOXY)–4–OXOBUTANOIC ACID, (S)-2-BENZYL-4-(TERT-BUTOXY)-4-OXOBUTANOIC ACID, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 200mg, 100mg.
(2S)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 337518-87-3) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: (2S)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: TWMRLCPQQCHIBH-LBPRGKRZSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (2S)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | TWMRLCPQQCHIBH-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)