Diisopropyl 3-oxocyclobutane-1,1-dicarboxylate, 96%
cas: 893724-10-2 — see every product listed under this CAS number, including other names
Diisopropyl 3-oxocyclobutane-1,1-dicarboxylate, 96% (CAS 893724-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A162069-1g |
| cas | 893724-10-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 492.75 Pln | |
| Ambeed | 500g | 2078.06 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 164.41 Pln | |
| BLDpharm | 25g | 197.73 Pln | |
| BLDpharm | 100g | 525.40 Pln | |
| BLDpharm | 500g | 2235.90 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Dipropan-2-yl 3-oxocyclobutane-1,1-dicarboxylate (CAS 893724-10-2) is a chemical compound with the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. IUPAC name: dipropan-2-yl 3-oxocyclobutane-1,1-dicarboxylate. InChIKey: WOHVVNMAISCDLA-UHFFFAOYSA-N.
| Molecular formula | C12H18O5 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | dipropan-2-yl 3-oxocyclobutane-1,1-dicarboxylate |
| InChIKey | WOHVVNMAISCDLA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(=O)C1)C(=O)OC(C)C |
Computed by PubChem (NCBI)
