Products 26593-41-9
CAS 26593-41-9 appears in our catalog under these names: Diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate, 95%, 6,6-diethyl 2-oxaspiro(3.3)heptane-6,6-dicarboxylate, Diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate 97%, Diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate, 97%, 97%, Diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
Diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate (CAS 26593-41-9) is a chemical compound with the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. IUPAC name: diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate. InChIKey: GSVZVHAUSWYWOS-UHFFFAOYSA-N.
| Molecular formula | C12H18O5 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | diethyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate |
| InChIKey | GSVZVHAUSWYWOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC2(C1)COC2)C(=O)OCC |
Computed by PubChem (NCBI)