CAS 57472-68-1 appears in our catalog under these names: 1-((1-(Acryloyloxy)propan-2-yl)oxy)propan-2-yl acrylate, 80% (stabilized with 400ppm MEHQ), 1-((1-(Acryloyloxy)propan-2-yl)oxy)propan-2-yl acrylate, >=80%(GC), mixture of isomers, Dipropylene Glycol Diacrylate, Dipropylene Glycol Diacrylate (~80%), DipropyleneGlycolDiacrylate(stabilizedwithMEHQ). Offered by: Chemat Brand, Fluorochem, TRC, GLPBio, Biosynth. Available pack sizes: on request, 5g, 25g, 2,5g, 250mg, 500mg, 500g, 250g.
1-(2-prop-2-enoyloxypropoxy)propan-2-yl prop-2-enoate (CAS 57472-68-1) is a chemical compound with the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. IUPAC name: 1-(2-prop-2-enoyloxypropoxy)propan-2-yl prop-2-enoate. InChIKey: RNJVAUBBYGWVBF-UHFFFAOYSA-N.
| Molecular formula | C12H18O5 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 1-(2-prop-2-enoyloxypropoxy)propan-2-yl prop-2-enoate |
| InChIKey | RNJVAUBBYGWVBF-UHFFFAOYSA-N |
| SMILES | CC(COCC(C)OC(=O)C=C)OC(=O)C=C |
Computed by PubChem (NCBI)