CAS 136994-78-0 appears in our catalog under these names: Ethyl (3aR,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydrobenzo[d][1,3]dioxole-5-carboxylate, 98%, Oseltamivir Impurity 85, Oseltamivir Impurity 8, Oseltamivir Impurity 2, Ethyl 3,4-O-isopropylideneshikimate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 5g.
Ethyl (3aR,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (CAS 136994-78-0) is a chemical compound with the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. IUPAC name: ethyl (3aR,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate. InChIKey: YDMLLAZCHMXIOO-BBBLOLIVSA-N.
| Molecular formula | C12H18O5 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | ethyl (3aR,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| InChIKey | YDMLLAZCHMXIOO-BBBLOLIVSA-N |
| SMILES | CCOC(=O)C1=C[C@@H]2[C@H]([C@@H](C1)O)OC(O2)(C)C |
Computed by PubChem (NCBI)