cas: 93655-34-6 — see every product listed under this CAS number, including other names
Dimethyl 1,8-Anthracenedicarboxylate, 98%, 98% (CAS 93655-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PKS-100mg |
| cas | 93655-34-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 822.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl anthracene-1,8-dicarboxylate (CAS 93655-34-6) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: dimethyl anthracene-1,8-dicarboxylate. InChIKey: ALYSIEHCBBJETD-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | dimethyl anthracene-1,8-dicarboxylate |
| InChIKey | ALYSIEHCBBJETD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=CC3=C(C=C21)C(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)