Dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 95+%
cas: 607362-87-8 — see every product listed under this CAS number, including other names
Dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 95+% (CAS 607362-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A773540-100mg |
| cas | 607362-87-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1060.12 Pln | |
| Ambeed | 250mg | 1749.88 Pln | |
| Ambeed | 1g | 4592.31 Pln | |
| Chemat | 100mg | 976.40 Pln | |
| Chemat | 250mg | 1610.00 Pln | |
| Chemat | 1g | 4240.40 Pln | |
| BLDpharm | 100mg | 1041.88 Pln | |
| BLDpharm | 250mg | 1713.87 Pln | |
| BLDpharm | 1g | 4507.33 Pln | |
| Fluorochem | 250mg | 2991.67 Pln | |
| Fluorochem | 1g | 7724.38 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate (CAS 607362-87-8) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate. InChIKey: JSRVVUSBZJFOJO-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate |
| InChIKey | JSRVVUSBZJFOJO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(CC1C(=O)OC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)