CAS 61935-48-6 appears in our catalog under these names: Z-1,2-Trans-achc-oh, 98%, trans-2-(Benzyloxycarbonylamino)cyclohexanecarboxylic acid, . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 5g, 1g.
Trans-(1S,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 61935-48-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: trans-(1S,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RPJMLWMATNCSIS-STQMWFEESA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | trans-(1S,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RPJMLWMATNCSIS-STQMWFEESA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)