CAS 1932256-61-5 appears in our catalog under these names: (2R,3R)-1-Cbz-2-methylpiperidine-3-carboxylic acid, 95%, (2R,3R)-1-Cbz-2-methylpiperidine-3-carboxylic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
(2R,3R)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1932256-61-5) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (2R,3R)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: QQCOVXZKKNSHFI-DGCLKSJQSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (2R,3R)-2-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | QQCOVXZKKNSHFI-DGCLKSJQSA-N |
| SMILES | C[C@@H]1[C@@H](CCCN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)