Products 1820674-23-4

CAS 1820674-23-4 is the registry number for methyl 1-{[(benzyloxy)carbonyl]amino}cyclopentane-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate (CAS 1820674-23-4) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: methyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate. InChIKey: NWOQEBJVJFVNAA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC namemethyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate
InChIKeyNWOQEBJVJFVNAA-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCCC1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)