cas: 150726-89-9 — see every product listed under this CAS number, including other names
Dimethyl 2-(2-methoxyphenoxy)malonate 95% (CAS 150726-89-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A252128-25g |
| cas | 150726-89-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 309.19 Pln | |
| Ambeed | 500g | 1010.06 Pln | |
| Ambeed | 1000g | 1672.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A252128 |
Dimethyl 2-(2-methoxyphenoxy)propanedioate (CAS 150726-89-9) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: dimethyl 2-(2-methoxyphenoxy)propanedioate. InChIKey: SBUXKADXTZOBJV-UHFFFAOYSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | dimethyl 2-(2-methoxyphenoxy)propanedioate |
| InChIKey | SBUXKADXTZOBJV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)