Products 96411-82-4
CAS 96411-82-4 appears in our catalog under these names: Dimethyl 5,6,11,12-Tetrahydrodibenzo[a,e][8]annulene-2,9-dicarboxylate, ≥95%, ≥95%, Dimethyl 5,6,11,12-tetrahydrodibenzo[a,e][8]annulene-2,9-dicarboxylate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Dimethyl tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene-6,15-dicarboxylate (CAS 96411-82-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: dimethyl tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene-6,15-dicarboxylate. InChIKey: NNBZNHONZITIQW-UHFFFAOYSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | dimethyl tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene-6,15-dicarboxylate |
| InChIKey | NNBZNHONZITIQW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCC3=C(CC2)C=C(C=C3)C(=O)OC)C=C1 |
Computed by PubChem (NCBI)