Products 811471-20-2
CAS 811471-20-2 is the registry number for Tsaokoarylone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4E,6E)-7-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)hepta-4,6-dien-3-one (CAS 811471-20-2) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: (4E,6E)-7-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)hepta-4,6-dien-3-one. InChIKey: VJBQUBGTUNBGDY-ZUVMSYQZSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (4E,6E)-7-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)hepta-4,6-dien-3-one |
| InChIKey | VJBQUBGTUNBGDY-ZUVMSYQZSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C=C/C(=O)CCC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)